Products 130413-38-6
CAS 130413-38-6 is the registry number for Methyl 6-amino-1H-purine-2-carboxylate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
Methyl 6-amino-7H-purine-2-carboxylate (CAS 130413-38-6) is a chemical compound with the molecular formula C7H7N5O2 and a molecular weight of 193.16 g/mol. IUPAC name: methyl 6-amino-7H-purine-2-carboxylate. InChIKey: GCOKIACILXQMEF-UHFFFAOYSA-N.
| Molecular formula | C7H7N5O2 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | methyl 6-amino-7H-purine-2-carboxylate |
| InChIKey | GCOKIACILXQMEF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC(=C2C(=N1)N=CN2)N |
Computed by PubChem (NCBI)