Products 130445-55-5
CAS 130445-55-5 is the registry number for PIM-35. Offered by: MedChemExpress. Available pack sizes: Get quote.
(5-methoxy-1H-indol-2-yl)methanamine (CAS 130445-55-5) is a chemical compound with the molecular formula C10H12N2O and a molecular weight of 176.21 g/mol. IUPAC name: (5-methoxy-1H-indol-2-yl)methanamine. InChIKey: UGMMLOHVKZGOJU-UHFFFAOYSA-N.
| Molecular formula | C10H12N2O |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | (5-methoxy-1H-indol-2-yl)methanamine |
| InChIKey | UGMMLOHVKZGOJU-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)NC(=C2)CN |
Computed by PubChem (NCBI)