Products 13055-64-6
CAS 13055-64-6 is the registry number for 2-Formyl-5-(trifluoromethyl)benzoic acid, ≥98.2%. Offered by: Chemat. Available pack sizes: 1g.
2-formyl-5-(trifluoromethyl)benzoic acid (CAS 13055-64-6) is a chemical compound with the molecular formula C9H5F3O3 and a molecular weight of 218.13 g/mol. IUPAC name: 2-formyl-5-(trifluoromethyl)benzoic acid. InChIKey: YPCYTLNHNSMEHT-UHFFFAOYSA-N.
| Molecular formula | C9H5F3O3 |
|---|---|
| Molecular weight | 218.13 g/mol |
| IUPAC name | 2-formyl-5-(trifluoromethyl)benzoic acid |
| InChIKey | YPCYTLNHNSMEHT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C(=O)O)C=O |
Computed by PubChem (NCBI)