CAS 130551-49-4 appears in our catalog under these names: L-4-Hydroxyphenyl-d4-alanine-2,3,3-d3, 98 atom % D, min 98% Chemical Purity, L-Tyrosine-alpha,beta,beta,2,3,5,6-d7, >95% (HPLC), L–Tyrosine–d7, L-Tyrosine-d7, 99.77%. Offered by: CDN, TRC, GLPBio, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 10mg, 1mg, 5mg, 10 mg.
(2S)-2-amino-2,3,3-trideuterio-3-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)propanoic acid (CAS 130551-49-4) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 188.23 g/mol. IUPAC name: (2S)-2-amino-2,3,3-trideuterio-3-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)propanoic acid. InChIKey: OUYCCCASQSFEME-BKKGXISKSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 188.23 g/mol |
| IUPAC name | (2S)-2-amino-2,3,3-trideuterio-3-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)propanoic acid |
| InChIKey | OUYCCCASQSFEME-BKKGXISKSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C([2H])([2H])[C@@]([2H])(C(=O)O)N)[2H])[2H])O)[2H] |
Computed by PubChem (NCBI)