Products 130569-31-2
CAS 130569-31-2 is the registry number for 5,6-dichloro-2,3-dihydro-1h-inden-1-ol, >97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
5,6-dichloro-2,3-dihydro-1H-inden-1-ol (CAS 130569-31-2) is a chemical compound with the molecular formula C9H8Cl2O and a molecular weight of 203.06 g/mol. IUPAC name: 5,6-dichloro-2,3-dihydro-1H-inden-1-ol. InChIKey: BVMSVJNZBKHOLJ-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O |
|---|---|
| Molecular weight | 203.06 g/mol |
| IUPAC name | 5,6-dichloro-2,3-dihydro-1H-inden-1-ol |
| InChIKey | BVMSVJNZBKHOLJ-UHFFFAOYSA-N |
| SMILES | C1CC2=CC(=C(C=C2C1O)Cl)Cl |
Computed by PubChem (NCBI)