Products 1306130-66-4
CAS 1306130-66-4 appears in our catalog under these names: 4-[[[4-(Aminomethyl)benzoyl]amino]methyl]benzoic acid, 95%, 95%, Tranexamic Acid Impurity 22. Offered by: Chemat, Hubei YoungXin. Available pack sizes: 100mg, 250mg, 1g, 10mg, 25mg, 50mg, 200mg.
4-[[[4-(aminomethyl)benzoyl]amino]methyl]benzoic acid (CAS 1306130-66-4) is a chemical compound with the molecular formula C16H16N2O3 and a molecular weight of 284.31 g/mol. IUPAC name: 4-[[[4-(aminomethyl)benzoyl]amino]methyl]benzoic acid. InChIKey: VJOGCODKOPULTE-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O3 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | 4-[[[4-(aminomethyl)benzoyl]amino]methyl]benzoic acid |
| InChIKey | VJOGCODKOPULTE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN)C(=O)NCC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)