Products 13065-86-6

CAS 13065-86-6 is the registry number for 4-Amino-3-hydroxy-2-naphthoic acid 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-amino-3-hydroxynaphthalene-2-carboxylic acid (CAS 13065-86-6) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: 4-amino-3-hydroxynaphthalene-2-carboxylic acid. InChIKey: VCJJAJXTFPNHON-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9NO3
Molecular weight203.19 g/mol
IUPAC name4-amino-3-hydroxynaphthalene-2-carboxylic acid
InChIKeyVCJJAJXTFPNHON-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C=C(C(=C2N)O)C(=O)O

Computed by PubChem (NCBI)