CAS 13065-86-6 is the registry number for 4-Amino-3-hydroxy-2-naphthoic acid 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
4-amino-3-hydroxynaphthalene-2-carboxylic acid (CAS 13065-86-6) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: 4-amino-3-hydroxynaphthalene-2-carboxylic acid. InChIKey: VCJJAJXTFPNHON-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 4-amino-3-hydroxynaphthalene-2-carboxylic acid |
| InChIKey | VCJJAJXTFPNHON-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C(=C2N)O)C(=O)O |
Computed by PubChem (NCBI)