CAS 13065-87-7 appears in our catalog under these names: 4-Amino-1-hydroxy-2-naphthoic acid, 98%, 4-Amino-1-hydroxy-2-naphthalenecarboxylic Acid. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 2,5g.
4-amino-1-hydroxynaphthalene-2-carboxylic acid (CAS 13065-87-7) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: 4-amino-1-hydroxynaphthalene-2-carboxylic acid. InChIKey: FGVNXCHIPUMQON-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 4-amino-1-hydroxynaphthalene-2-carboxylic acid |
| InChIKey | FGVNXCHIPUMQON-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=C2O)C(=O)O)N |
Computed by PubChem (NCBI)