CAS 130671-88-4 appears in our catalog under these names: 9-(Pyridin-4-yl)-9H-carbazole 95%, 9-(Pyridin-4-yl)-9H-carbazole, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
9-pyridin-4-ylcarbazole (CAS 130671-88-4) is a chemical compound with the molecular formula C17H12N2 and a molecular weight of 244.29 g/mol. IUPAC name: 9-pyridin-4-ylcarbazole. InChIKey: RNUQXDKCHQFSOM-UHFFFAOYSA-N.
| Molecular formula | C17H12N2 |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | 9-pyridin-4-ylcarbazole |
| InChIKey | RNUQXDKCHQFSOM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3N2C4=CC=NC=C4 |
Computed by PubChem (NCBI)