CAS 23866-67-3 is the registry number for 9-(Pyridin-2-yl)-9H-carbazole, 97%. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g.
9-pyridin-2-ylcarbazole (CAS 23866-67-3) is a chemical compound with the molecular formula C17H12N2 and a molecular weight of 244.29 g/mol. IUPAC name: 9-pyridin-2-ylcarbazole. InChIKey: JDINBEDUGBFLEC-UHFFFAOYSA-N.
| Molecular formula | C17H12N2 |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | 9-pyridin-2-ylcarbazole |
| InChIKey | JDINBEDUGBFLEC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3N2C4=CC=CC=N4 |
Computed by PubChem (NCBI)