CAS 1541200-53-6 appears in our catalog under these names: 5–Phenyl–5H–pyrido(3,2–b)indole, 5-Phenyl-5H-pyrido[3,2-b]indole, >98.0%(GC), 5-Phenyl-5H-pyrido(3,2-b)indole, 5-Phenyl-5H-pyrido[3,2-b]indole, 98%, 98%, 5-PHENYL-5H-PYRIDO[3,2-B]INDOLE, 98%. Offered by: GLPBio, TCI, Biosynth, Chemat, Fluorochem. Available pack sizes: 200mg, 1g, 0,5g, 100mg.
5-phenylpyrido[3,2-b]indole (CAS 1541200-53-6) is a chemical compound with the molecular formula C17H12N2 and a molecular weight of 244.29 g/mol. IUPAC name: 5-phenylpyrido[3,2-b]indole. InChIKey: NGQWQTGGMORPSA-UHFFFAOYSA-N.
| Molecular formula | C17H12N2 |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | 5-phenylpyrido[3,2-b]indole |
| InChIKey | NGQWQTGGMORPSA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C3=C(C4=CC=CC=C42)N=CC=C3 |
Computed by PubChem (NCBI)