Products 16765-79-0
CAS 16765-79-0 appears in our catalog under these names: 1-Phenyl-9H-pyrido(3,4-b)indole, 95-<97%, 1–Phenyl–9H–?carboline. Offered by: Hoffman Fine Chemicals, GLPBio. Available pack sizes: 2,5g, 5g, 10g, 1mg, 5mg.
1-phenyl-9H-pyrido[3,4-b]indole (CAS 16765-79-0) is a chemical compound with the molecular formula C17H12N2 and a molecular weight of 244.29 g/mol. IUPAC name: 1-phenyl-9H-pyrido[3,4-b]indole. InChIKey: WOHXZRIXRLZSBI-UHFFFAOYSA-N.
| Molecular formula | C17H12N2 |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | 1-phenyl-9H-pyrido[3,4-b]indole |
| InChIKey | WOHXZRIXRLZSBI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC=CC3=C2NC4=CC=CC=C34 |
Computed by PubChem (NCBI)