CAS 2562-81-4 is the registry number for 2-(Naphthalen-1-yl)-1H-1,3-benzodiazole. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-naphthalen-1-yl-1H-benzimidazole (CAS 2562-81-4) is a chemical compound with the molecular formula C17H12N2 and a molecular weight of 244.29 g/mol. IUPAC name: 2-naphthalen-1-yl-1H-benzimidazole. InChIKey: PAOHHYDZFURJKA-UHFFFAOYSA-N.
| Molecular formula | C17H12N2 |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | 2-naphthalen-1-yl-1H-benzimidazole |
| InChIKey | PAOHHYDZFURJKA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C3=NC4=CC=CC=C4N3 |
Computed by PubChem (NCBI)