Products 1307299-54-2
CAS 1307299-54-2 appears in our catalog under these names: (Z)-5-(2-Methoxybenzylidene)thiazolidine-2,4-dione, 95%, (Z)-5-(2-Methoxybenzylidene)thiazolidine-2,4-dione, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 1g, 250mg, 100mg.
(5Z)-5-[(2-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione (CAS 1307299-54-2) is a chemical compound with the molecular formula C11H9NO3S and a molecular weight of 235.26 g/mol. IUPAC name: (5Z)-5-[(2-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione. InChIKey: LJEQHDQLEYCLSC-TWGQIWQCSA-N.
| Molecular formula | C11H9NO3S |
|---|---|
| Molecular weight | 235.26 g/mol |
| IUPAC name | (5Z)-5-[(2-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| InChIKey | LJEQHDQLEYCLSC-TWGQIWQCSA-N |
| SMILES | COC1=CC=CC=C1/C=C\2/C(=O)NC(=O)S2 |
Computed by PubChem (NCBI)