CAS 1307516-30-8 appears in our catalog under these names: Benzyl 3-amino-4-fluorobenzoate, 95%, Benzyl 3-amino-4-fluorobenzoate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
Benzyl 3-amino-4-fluorobenzoate (CAS 1307516-30-8) is a chemical compound with the molecular formula C14H12FNO2 and a molecular weight of 245.25 g/mol. IUPAC name: benzyl 3-amino-4-fluorobenzoate. InChIKey: QDWCLHABHDGMFY-UHFFFAOYSA-N.
| Molecular formula | C14H12FNO2 |
|---|---|
| Molecular weight | 245.25 g/mol |
| IUPAC name | benzyl 3-amino-4-fluorobenzoate |
| InChIKey | QDWCLHABHDGMFY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=CC(=C(C=C2)F)N |
Computed by PubChem (NCBI)