Products 2027537-24-0
CAS 2027537-24-0 appears in our catalog under these names: 3-(Dimethylamino)-5-fluorobenzoic acid methyl ester, 95%, 3-(Dimethylamino)-5-fluorobenzoic acid methyl ester. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
Methyl 3-(dimethylamino)-5-fluorobenzoate (CAS 2027537-24-0) is a chemical compound with the molecular formula C10H12FNO2 and a molecular weight of 197.21 g/mol. IUPAC name: methyl 3-(dimethylamino)-5-fluorobenzoate. InChIKey: MYFQOVKOOOEVOH-UHFFFAOYSA-N.
| Molecular formula | C10H12FNO2 |
|---|---|
| Molecular weight | 197.21 g/mol |
| IUPAC name | methyl 3-(dimethylamino)-5-fluorobenzoate |
| InChIKey | MYFQOVKOOOEVOH-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC(=CC(=C1)C(=O)OC)F |
Computed by PubChem (NCBI)