Products 1308650-31-8
CAS 1308650-31-8 is the registry number for 1-(4-Chlorophenyl)-5-ethyl-2-sulfanylidene-1,3-diazinane-4,6-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(4-chlorophenyl)-5-ethyl-2-sulfanylidene-1,3-diazinane-4,6-dione (CAS 1308650-31-8) is a chemical compound with the molecular formula C12H11ClN2O2S and a molecular weight of 282.75 g/mol. IUPAC name: 1-(4-chlorophenyl)-5-ethyl-2-sulfanylidene-1,3-diazinane-4,6-dione. InChIKey: TUSJVIDIUXHTAF-UHFFFAOYSA-N.
| Molecular formula | C12H11ClN2O2S |
|---|---|
| Molecular weight | 282.75 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-5-ethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| InChIKey | TUSJVIDIUXHTAF-UHFFFAOYSA-N |
| SMILES | CCC1C(=O)NC(=S)N(C1=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)