Products 130897-87-9
CAS 130897-87-9 appears in our catalog under these names: 1，10–PHENANTHROLINE–4，7–DICARBOXALDEHYDE, 1,10-Phenanthroline-4,7-dicarbaldehyde, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 100mg.
1,10-phenanthroline-4,7-dicarbaldehyde (CAS 130897-87-9) is a chemical compound with the molecular formula C14H8N2O2 and a molecular weight of 236.22 g/mol. IUPAC name: 1,10-phenanthroline-4,7-dicarbaldehyde. InChIKey: HCJOBZLFARGFLG-UHFFFAOYSA-N.
| Molecular formula | C14H8N2O2 |
|---|---|
| Molecular weight | 236.22 g/mol |
| IUPAC name | 1,10-phenanthroline-4,7-dicarbaldehyde |
| InChIKey | HCJOBZLFARGFLG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2C3=NC=CC(=C31)C=O)C=O |
Computed by PubChem (NCBI)