Products 60755-87-5
CAS 60755-87-5 is the registry number for Canthin-6-one N-oxide. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 10mg, 50mg, Get quote.
6-oxido-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-6-ium-2-one (CAS 60755-87-5) is a chemical compound with the molecular formula C14H8N2O2 and a molecular weight of 236.22 g/mol. IUPAC name: 6-oxido-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-6-ium-2-one. InChIKey: PMKULNRVYULJPO-UHFFFAOYSA-N.
| Molecular formula | C14H8N2O2 |
|---|---|
| Molecular weight | 236.22 g/mol |
| IUPAC name | 6-oxido-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-6-ium-2-one |
| InChIKey | PMKULNRVYULJPO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C4N2C(=O)C=CC4=[N+](C=C3)[O-] |
Computed by PubChem (NCBI)