CAS 2368860-30-2 is the registry number for 1,10-Phenanthroline-3,8-dicarbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,10-phenanthroline-3,8-dicarbaldehyde (CAS 2368860-30-2) is a chemical compound with the molecular formula C14H8N2O2 and a molecular weight of 236.22 g/mol. IUPAC name: 1,10-phenanthroline-3,8-dicarbaldehyde. InChIKey: KHHWQKIGVJXSMT-UHFFFAOYSA-N.
| Molecular formula | C14H8N2O2 |
|---|---|
| Molecular weight | 236.22 g/mol |
| IUPAC name | 1,10-phenanthroline-3,8-dicarbaldehyde |
| InChIKey | KHHWQKIGVJXSMT-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CN=C2C3=NC=C(C=C31)C=O)C=O |
Computed by PubChem (NCBI)