CAS 57709-62-3 appears in our catalog under these names: 2,9–Diformyl–1,10–phenanthroline, 1,10-Phenanthroline-2,9-dicarbaldehyde, 95%, 95%, 1,10-Phenanthroline-2,9-dicarbaldehyde, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 500mg, 5g, 100mg, 25g, 2.5g, 10g.
1,10-phenanthroline-2,9-dicarbaldehyde (CAS 57709-62-3) is a chemical compound with the molecular formula C14H8N2O2 and a molecular weight of 236.22 g/mol. IUPAC name: 1,10-phenanthroline-2,9-dicarbaldehyde. InChIKey: RHXOPVFYZBGQGA-UHFFFAOYSA-N.
| Molecular formula | C14H8N2O2 |
|---|---|
| Molecular weight | 236.22 g/mol |
| IUPAC name | 1,10-phenanthroline-2,9-dicarbaldehyde |
| InChIKey | RHXOPVFYZBGQGA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C3=C1C=CC(=N3)C=O)N=C(C=C2)C=O |
Computed by PubChem (NCBI)