Products 64118-73-6
CAS 64118-73-6 is the registry number for 5-Hydroxycanthin-6-one. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-hydroxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-2-one (CAS 64118-73-6) is a chemical compound with the molecular formula C14H8N2O2 and a molecular weight of 236.22 g/mol. IUPAC name: 3-hydroxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-2-one. InChIKey: HOTCTNQHGRFRLK-UHFFFAOYSA-N.
| Molecular formula | C14H8N2O2 |
|---|---|
| Molecular weight | 236.22 g/mol |
| IUPAC name | 3-hydroxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-2-one |
| InChIKey | HOTCTNQHGRFRLK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C4N2C(=O)C(=CC4=NC=C3)O |
Computed by PubChem (NCBI)