CAS 1309598-55-7 appears in our catalog under these names: (R)–1–(2–Fluoro–4–methoxyphenyl)ethanamine hydrochloride, (R)-1-(2-Fluoro-4-methoxyphenyl)ethanamine hydrochloride, 98%, 98%, (R)-1-(2-Fluoro-4-methoxyphenyl)ethanamine hydrochloride, 95%. Offered by: GLPBio, Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
(1R)-1-(2-fluoro-4-methoxyphenyl)ethanamine;hydrochloride (CAS 1309598-55-7) is a chemical compound with the molecular formula C9H13ClFNO and a molecular weight of 205.66 g/mol. IUPAC name: (1R)-1-(2-fluoro-4-methoxyphenyl)ethanamine;hydrochloride. InChIKey: PFGPYFQNNQZFTB-FYZOBXCZSA-N.
| Molecular formula | C9H13ClFNO |
|---|---|
| Molecular weight | 205.66 g/mol |
| IUPAC name | (1R)-1-(2-fluoro-4-methoxyphenyl)ethanamine;hydrochloride |
| InChIKey | PFGPYFQNNQZFTB-FYZOBXCZSA-N |
| SMILES | C[C@H](C1=C(C=C(C=C1)OC)F)N.Cl |
Computed by PubChem (NCBI)