CAS 1309602-79-6 appears in our catalog under these names: 1-(2-Fluoro-4-methoxyphenyl)ethanamine hydrochloride, 95%, 1–(2–Fluoro–4–methoxyphenyl)ethanamine hydrochloride, 1-(2-Fluoro-4-methoxyphenyl)ethylamine hydrochloride. Offered by: AmBeed, GLPBio, Biosynth. Available pack sizes: 50mg, 100mg, 25mg, 250mg.
1-(2-fluoro-4-methoxyphenyl)ethanamine;hydrochloride (CAS 1309602-79-6) is a chemical compound with the molecular formula C9H13ClFNO and a molecular weight of 205.66 g/mol. IUPAC name: 1-(2-fluoro-4-methoxyphenyl)ethanamine;hydrochloride. InChIKey: PFGPYFQNNQZFTB-UHFFFAOYSA-N.
| Molecular formula | C9H13ClFNO |
|---|---|
| Molecular weight | 205.66 g/mol |
| IUPAC name | 1-(2-fluoro-4-methoxyphenyl)ethanamine;hydrochloride |
| InChIKey | PFGPYFQNNQZFTB-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=C(C=C1)OC)F)N.Cl |
Computed by PubChem (NCBI)