CAS 1310383-42-6 appears in our catalog under these names: 5-METHYL-1H-INDAZOL-6-YL-6-BORONIC ACID, 95%, 5-Methyl-1H-indazole-6-boronic acid, 97%, (5-Methyl-1H-indazol-6-yl)boronic acid 97%, (5-Methyl-1H-indazol-6-yl)boronic acid, 95%, 95%. Offered by: Fluorochem, Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg.
(5-methyl-1H-indazol-6-yl)boronic acid (CAS 1310383-42-6) is a chemical compound with the molecular formula C8H9BN2O2 and a molecular weight of 175.98 g/mol. IUPAC name: (5-methyl-1H-indazol-6-yl)boronic acid. InChIKey: FVSYCXICBAFOGW-UHFFFAOYSA-N.
| Molecular formula | C8H9BN2O2 |
|---|---|
| Molecular weight | 175.98 g/mol |
| IUPAC name | (5-methyl-1H-indazol-6-yl)boronic acid |
| InChIKey | FVSYCXICBAFOGW-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1C)C=NN2)(O)O |
Computed by PubChem (NCBI)