CAS 1310404-46-6 appears in our catalog under these names: 7-Methyl-1h-indazole-4-boronic acid, 95%, 7-METHYL-1H-INDAZOL-4-YL-4-BORONIC ACID. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g.
(7-methyl-1H-indazol-4-yl)boronic acid (CAS 1310404-46-6) is a chemical compound with the molecular formula C8H9BN2O2 and a molecular weight of 175.98 g/mol. IUPAC name: (7-methyl-1H-indazol-4-yl)boronic acid. InChIKey: VXZXPPCPIAEUIA-UHFFFAOYSA-N.
| Molecular formula | C8H9BN2O2 |
|---|---|
| Molecular weight | 175.98 g/mol |
| IUPAC name | (7-methyl-1H-indazol-4-yl)boronic acid |
| InChIKey | VXZXPPCPIAEUIA-UHFFFAOYSA-N |
| SMILES | B(C1=C2C=NNC2=C(C=C1)C)(O)O |
Computed by PubChem (NCBI)