Products 1310680-01-3
CAS 1310680-01-3 appears in our catalog under these names: Hydrouracil-3-PhOH, 1-(3-Hydroxyphenyl)dihydropyrimidine-2,4(1H,3H)-dione, 98%, 1-(3-Hydroxyphenyl)dihydropyrimidine-2,4(1H,3H)-dione 98%, Dihydro-1-(3-hydroxyphenyl)-2,4(1H,3H)-pyrimidinedione, 98%, 98%, Dihydro-1-(3-hydroxyphenyl)-2,4(1H,3H)-pyrimidinedione, 98%. Offered by: MedChemExpress, Chemat Brand, Ambeed, Chemat, Fluorochem. Available pack sizes: 100 mg, 50 mg, 25 mg, 250 mg, 250mg, 100mg, 1g.
1-(3-hydroxyphenyl)-1,3-diazinane-2,4-dione (CAS 1310680-01-3) is a chemical compound with the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. IUPAC name: 1-(3-hydroxyphenyl)-1,3-diazinane-2,4-dione. InChIKey: NUEWZBOGLYTCGZ-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O3 |
|---|---|
| Molecular weight | 206.20 g/mol |
| IUPAC name | 1-(3-hydroxyphenyl)-1,3-diazinane-2,4-dione |
| InChIKey | NUEWZBOGLYTCGZ-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=CC(=CC=C2)O |
Computed by PubChem (NCBI)