CAS 1310680-18-2 appears in our catalog under these names: Boc-4-amino-3,3-dimethyl-butyric acid, 95%, Boc-GABA(3,3-Me2)-OH, 4-((tert-Butoxycarbonyl)amino)-3,3-dimethylbutanoic acid 95%, 4-[[(1,1-Dimethylethoxy)carbonyl]amino]-3,3-dimethylbutanoic acid, 95%, 95%, Boc-4-amino-3,3-dimethyl-butyric acid, 97%. Offered by: Combi-blocks, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
3,3-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 1310680-18-2) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: 3,3-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: MFKIFVQJZNMZJB-UHFFFAOYSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | 3,3-dimethyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | MFKIFVQJZNMZJB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC(C)(C)CC(=O)O |
Computed by PubChem (NCBI)