CAS 1310680-39-7 appears in our catalog under these names: (R)-Boc-2-amino-3-ethyl-pentanoic acid, 95%, Boc-D-Nva(3-Et)-OH, Boc-3-Et-D-Nva-OH 97%. Offered by: Combi-blocks, Iris Biotech, Ambeed. Available pack sizes: 1g, 250mg, 5g, 100mg.
(2R)-3-ethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 1310680-39-7) is a chemical compound with the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. IUPAC name: (2R)-3-ethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: IWFUADFCRJVRNH-SECBINFHSA-N.
| Molecular formula | C12H23NO4 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | (2R)-3-ethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | IWFUADFCRJVRNH-SECBINFHSA-N |
| SMILES | CCC(CC)[C@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)