CAS 35264-04-1 appears in our catalog under these names: N-Boc-3-ethyl l-norvaline, 95%, N-Boc-3-ethyl L-Norvaline, Boc-L-Nva(3-Et)-OH, Boc-3-Et-Nva-OH 95%, (S)-2-((tert-Butoxycarbonyl)amino)-3-ethylpentanoic acid, 95%+, 95%+. Offered by: Combi-blocks, TRC, Iris Biotech, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg, 50mg, 500mg.
(2S)-3-ethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 35264-04-1) is a chemical compound with the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. IUPAC name: (2S)-3-ethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: IWFUADFCRJVRNH-VIFPVBQESA-N.
| Molecular formula | C12H23NO4 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | (2S)-3-ethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | IWFUADFCRJVRNH-VIFPVBQESA-N |
| SMILES | CCC(CC)[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)