CAS 1310680-41-1 appears in our catalog under these names: (S)-Fmoc-2-amino-3,3-dimethyl-pent-4-enoic acid, 95%, (S)-Fmoc-2-amino-3,3-dimethyl-pent-4-enoic acid, 97%, 2-(Fmoc-amino)-3,3-diMe-pent-4-enoic acid (S), Fmoc-3-Vinyl-Val-OH 95%, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3,3-dimethylpent-4-enoic acid, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Iris Biotech, Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,3-dimethylpent-4-enoic acid (CAS 1310680-41-1) is a chemical compound with the molecular formula C22H23NO4 and a molecular weight of 365.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,3-dimethylpent-4-enoic acid. InChIKey: KSFBTMRFQUMTJS-LJQANCHMSA-N.
| Molecular formula | C22H23NO4 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,3-dimethylpent-4-enoic acid |
| InChIKey | KSFBTMRFQUMTJS-LJQANCHMSA-N |
| SMILES | CC(C)(C=C)[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)