CAS 1311184-95-8 appears in our catalog under these names: {2-((2-chloro-4-fluorophenyl)methoxy)phenyl}boronic acid, 95%, {2-((2-Chloro-4-fluorophenyl)methoxy)phenyl}boronic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
[2-[(2-chloro-4-fluorophenyl)methoxy]phenyl]boronic acid (CAS 1311184-95-8) is a chemical compound with the molecular formula C13H11BClFO3 and a molecular weight of 280.49 g/mol. IUPAC name: [2-[(2-chloro-4-fluorophenyl)methoxy]phenyl]boronic acid. InChIKey: FTSJBROJHPEWPI-UHFFFAOYSA-N.
| Molecular formula | C13H11BClFO3 |
|---|---|
| Molecular weight | 280.49 g/mol |
| IUPAC name | [2-[(2-chloro-4-fluorophenyl)methoxy]phenyl]boronic acid |
| InChIKey | FTSJBROJHPEWPI-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1OCC2=C(C=C(C=C2)F)Cl)(O)O |
Computed by PubChem (NCBI)