Products 1311254-57-5

CAS 1311254-57-5 appears in our catalog under these names: Ethyl isoindoline-4-carboxylate hydrochloride, 95%, ETHYL ISOINDOLINE-4-CARBOXYLATE HYDROCHLORIDE, 98%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

Ethyl 2,3-dihydro-1H-isoindole-4-carboxylate;hydrochloride (CAS 1311254-57-5) is a chemical compound with the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. IUPAC name: ethyl 2,3-dihydro-1H-isoindole-4-carboxylate;hydrochloride. InChIKey: RNFFUJIMDNSFTL-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14ClNO2
Molecular weight227.69 g/mol
IUPAC nameethyl 2,3-dihydro-1H-isoindole-4-carboxylate;hydrochloride
InChIKeyRNFFUJIMDNSFTL-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC=CC2=C1CNC2.Cl

Computed by PubChem (NCBI)