CAS 1311315-41-9 appears in our catalog under these names: 3-((3-(2-Aminoethyl)ureido)methyl)benzoic acid hydrochloride, 95+%, 3-({((2-Aminoethyl)carbamoyl)amino}methyl)benzoic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-[(2-aminoethylcarbamoylamino)methyl]benzoic acid;hydrochloride (CAS 1311315-41-9) is a chemical compound with the molecular formula C11H16ClN3O3 and a molecular weight of 273.71 g/mol. IUPAC name: 3-[(2-aminoethylcarbamoylamino)methyl]benzoic acid;hydrochloride. InChIKey: JBELIKQPMJHPOK-UHFFFAOYSA-N.
| Molecular formula | C11H16ClN3O3 |
|---|---|
| Molecular weight | 273.71 g/mol |
| IUPAC name | 3-[(2-aminoethylcarbamoylamino)methyl]benzoic acid;hydrochloride |
| InChIKey | JBELIKQPMJHPOK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)CNC(=O)NCCN.Cl |
Computed by PubChem (NCBI)