Products 2138103-92-9
CAS 2138103-92-9 is the registry number for tert-Butyl 3-(5-(chloromethyl)-1,2,4-oxadiazol-3-yl)azetidine-1-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl 3-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]azetidine-1-carboxylate (CAS 2138103-92-9) is a chemical compound with the molecular formula C11H16ClN3O3 and a molecular weight of 273.71 g/mol. IUPAC name: tert-butyl 3-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]azetidine-1-carboxylate. InChIKey: YXOZYCDEXLJEJI-UHFFFAOYSA-N.
| Molecular formula | C11H16ClN3O3 |
|---|---|
| Molecular weight | 273.71 g/mol |
| IUPAC name | tert-butyl 3-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]azetidine-1-carboxylate |
| InChIKey | YXOZYCDEXLJEJI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)C2=NOC(=N2)CCl |
Computed by PubChem (NCBI)