CAS 950124-73-9 is the registry number for 3-Chloro-N-{2,4-dioxo-1,3-diazaspiro(4.5)decan-3-yl}propanamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-chloro-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanamide (CAS 950124-73-9) is a chemical compound with the molecular formula C11H16ClN3O3 and a molecular weight of 273.71 g/mol. IUPAC name: 3-chloro-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanamide. InChIKey: SOXPZRLWSZGMDT-UHFFFAOYSA-N.
| Molecular formula | C11H16ClN3O3 |
|---|---|
| Molecular weight | 273.71 g/mol |
| IUPAC name | 3-chloro-N-(2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)propanamide |
| InChIKey | SOXPZRLWSZGMDT-UHFFFAOYSA-N |
| SMILES | C1CCC2(CC1)C(=O)N(C(=O)N2)NC(=O)CCCl |
Computed by PubChem (NCBI)