Products 299912-45-1
CAS 299912-45-1 is the registry number for 1-(4-Methoxy-2-nitrophenyl)piperazine Hydrochloride. Offered by: TRC. Available pack sizes: 500mg.
1-(4-methoxy-2-nitrophenyl)piperazine;hydrochloride (CAS 299912-45-1) is a chemical compound with the molecular formula C11H16ClN3O3 and a molecular weight of 273.71 g/mol. IUPAC name: 1-(4-methoxy-2-nitrophenyl)piperazine;hydrochloride. InChIKey: SCLRHZIZIRHLQI-UHFFFAOYSA-N.
| Molecular formula | C11H16ClN3O3 |
|---|---|
| Molecular weight | 273.71 g/mol |
| IUPAC name | 1-(4-methoxy-2-nitrophenyl)piperazine;hydrochloride |
| InChIKey | SCLRHZIZIRHLQI-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)N2CCNCC2)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)