CAS 77835-49-5 appears in our catalog under these names: L-Valine p-nitroanilide hydrochloride, 95%, (S)-2-Amino-3-methyl-N-(4-nitrophenyl)butanamide hydrochloride, 97%, H–Val–pNA · HCl, H-L-Val-pNA*HCl, H-Val-PNA.Hcl 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Iris Biotech, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg.
(2S)-2-amino-3-methyl-N-(4-nitrophenyl)butanamide;hydrochloride (CAS 77835-49-5) is a chemical compound with the molecular formula C11H16ClN3O3 and a molecular weight of 273.71 g/mol. IUPAC name: (2S)-2-amino-3-methyl-N-(4-nitrophenyl)butanamide;hydrochloride. InChIKey: BGTMFJBVZIWWCC-PPHPATTJSA-N.
| Molecular formula | C11H16ClN3O3 |
|---|---|
| Molecular weight | 273.71 g/mol |
| IUPAC name | (2S)-2-amino-3-methyl-N-(4-nitrophenyl)butanamide;hydrochloride |
| InChIKey | BGTMFJBVZIWWCC-PPHPATTJSA-N |
| SMILES | CC(C)[C@@H](C(=O)NC1=CC=C(C=C1)[N+](=O)[O-])N.Cl |
Computed by PubChem (NCBI)