Products 1311746-26-5
CAS 1311746-26-5 is the registry number for 5-Nitro-2-(1-oxidothiomorpholino)benzonitrile, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-nitro-2-(1-oxo-1,4-thiazinan-4-yl)benzonitrile (CAS 1311746-26-5) is a chemical compound with the molecular formula C11H11N3O3S and a molecular weight of 265.29 g/mol. IUPAC name: 5-nitro-2-(1-oxo-1,4-thiazinan-4-yl)benzonitrile. InChIKey: VWLHSIVULYIDRI-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O3S |
|---|---|
| Molecular weight | 265.29 g/mol |
| IUPAC name | 5-nitro-2-(1-oxo-1,4-thiazinan-4-yl)benzonitrile |
| InChIKey | VWLHSIVULYIDRI-UHFFFAOYSA-N |
| SMILES | C1CS(=O)CCN1C2=C(C=C(C=C2)[N+](=O)[O-])C#N |
Computed by PubChem (NCBI)