CAS 2115659-62-4 is the registry number for R079. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(E)-2-(benzenesulfonyl)ethenyl]-4-methyl-1,2,4-triazol-3-one (CAS 2115659-62-4) is a chemical compound with the molecular formula C11H11N3O3S and a molecular weight of 265.29 g/mol. IUPAC name: 2-[(E)-2-(benzenesulfonyl)ethenyl]-4-methyl-1,2,4-triazol-3-one. InChIKey: CJXKQUHAYXQJFB-BQYQJAHWSA-N.
| Molecular formula | C11H11N3O3S |
|---|---|
| Molecular weight | 265.29 g/mol |
| IUPAC name | 2-[(E)-2-(benzenesulfonyl)ethenyl]-4-methyl-1,2,4-triazol-3-one |
| InChIKey | CJXKQUHAYXQJFB-BQYQJAHWSA-N |
| SMILES | CN1C=NN(C1=O)/C=C/S(=O)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)