CAS 138712-82-0 is the registry number for (4-methoxyphenyl)-N-(3-methyl-4-oxo(2,3,5-thiadiazolinyl))formamide. Offered by: Biosynth. Available pack sizes: 250mg.
4-methoxy-N-(2-methyl-3-oxo-1,2,4-thiadiazol-5-yl)benzamide (CAS 138712-82-0) is a chemical compound with the molecular formula C11H11N3O3S and a molecular weight of 265.29 g/mol. IUPAC name: 4-methoxy-N-(2-methyl-3-oxo-1,2,4-thiadiazol-5-yl)benzamide. InChIKey: OGFJHFKPSZKPLV-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O3S |
|---|---|
| Molecular weight | 265.29 g/mol |
| IUPAC name | 4-methoxy-N-(2-methyl-3-oxo-1,2,4-thiadiazol-5-yl)benzamide |
| InChIKey | OGFJHFKPSZKPLV-UHFFFAOYSA-N |
| SMILES | CN1C(=O)N=C(S1)NC(=O)C2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)