Products 170033-08-6
CAS 170033-08-6 is the registry number for 4-Ketobenzotriazine-CH2-S-(CH2)2-COOH. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[(4-oxo-1,2,3-benzotriazin-3-yl)methylsulfanyl]propanoic acid (CAS 170033-08-6) is a chemical compound with the molecular formula C11H11N3O3S and a molecular weight of 265.29 g/mol. IUPAC name: 3-[(4-oxo-1,2,3-benzotriazin-3-yl)methylsulfanyl]propanoic acid. InChIKey: IJYMTTGJQIASLL-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O3S |
|---|---|
| Molecular weight | 265.29 g/mol |
| IUPAC name | 3-[(4-oxo-1,2,3-benzotriazin-3-yl)methylsulfanyl]propanoic acid |
| InChIKey | IJYMTTGJQIASLL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(N=N2)CSCCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Ketobenzotriazine-CH2-S-(CH2)2-COOH, orb3143362