CAS 50930-57-9 is the registry number for 5-Hydroxysulfapyridine, >95% (HPLC). Offered by: TRC. Available pack sizes: 250mg, 25mg.
4-amino-N-(5-hydroxy-2-pyridinyl)benzenesulfonamide (CAS 50930-57-9) is a chemical compound with the molecular formula C11H11N3O3S and a molecular weight of 265.29 g/mol. IUPAC name: 4-amino-N-(5-hydroxy-2-pyridinyl)benzenesulfonamide. InChIKey: XMCHHHBDBWYWSU-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O3S |
|---|---|
| Molecular weight | 265.29 g/mol |
| IUPAC name | 4-amino-N-(5-hydroxy-2-pyridinyl)benzenesulfonamide |
| InChIKey | XMCHHHBDBWYWSU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)S(=O)(=O)NC2=NC=C(C=C2)O |
Computed by PubChem (NCBI)