CAS 1311992-92-3 is the registry number for Ethyl 2-(3-bromoquinolin-6-yl)propanoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-(3-bromoquinolin-6-yl)propanoate (CAS 1311992-92-3) is a chemical compound with the molecular formula C14H14BrNO2 and a molecular weight of 308.17 g/mol. IUPAC name: ethyl 2-(3-bromoquinolin-6-yl)propanoate. InChIKey: QAIDRRNYBDYSNI-UHFFFAOYSA-N.
| Molecular formula | C14H14BrNO2 |
|---|---|
| Molecular weight | 308.17 g/mol |
| IUPAC name | ethyl 2-(3-bromoquinolin-6-yl)propanoate |
| InChIKey | QAIDRRNYBDYSNI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)C1=CC2=CC(=CN=C2C=C1)Br |
Computed by PubChem (NCBI)