CAS 25407-31-2 is the registry number for 1-[2-(4-Methoxyphenyl)-2-oxoethyl]pyridinium bromide, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-(4-methoxyphenyl)-2-pyridin-1-ium-1-ylethanone bromide (CAS 25407-31-2) is a chemical compound with the molecular formula C14H14BrNO2 and a molecular weight of 308.17 g/mol. IUPAC name: 1-(4-methoxyphenyl)-2-pyridin-1-ium-1-ylethanone bromide. InChIKey: LGUYCPJMAQARCQ-UHFFFAOYSA-M.
| Molecular formula | C14H14BrNO2 |
|---|---|
| Molecular weight | 308.17 g/mol |
| IUPAC name | 1-(4-methoxyphenyl)-2-pyridin-1-ium-1-ylethanone bromide |
| InChIKey | LGUYCPJMAQARCQ-UHFFFAOYSA-M |
| SMILES | COC1=CC=C(C=C1)C(=O)C[N+]2=CC=CC=C2.[Br-] |
Computed by PubChem (NCBI)