Products 2167503-36-6
CAS 2167503-36-6 is the registry number for 3-Benzyl-6-(bromomethyl)-3-azabicyclo[3.2.0]heptane-2,4-dione, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-benzyl-6-(bromomethyl)-3-azabicyclo[3.2.0]heptane-2,4-dione (CAS 2167503-36-6) is a chemical compound with the molecular formula C14H14BrNO2 and a molecular weight of 308.17 g/mol. IUPAC name: 3-benzyl-6-(bromomethyl)-3-azabicyclo[3.2.0]heptane-2,4-dione. InChIKey: AVRRHLDIMKSGPE-UHFFFAOYSA-N.
| Molecular formula | C14H14BrNO2 |
|---|---|
| Molecular weight | 308.17 g/mol |
| IUPAC name | 3-benzyl-6-(bromomethyl)-3-azabicyclo[3.2.0]heptane-2,4-dione |
| InChIKey | AVRRHLDIMKSGPE-UHFFFAOYSA-N |
| SMILES | C1C(C2C1C(=O)N(C2=O)CC3=CC=CC=C3)CBr |
Computed by PubChem (NCBI)