CAS 61343-15-5 appears in our catalog under these names: 2-(4-Bromophenyl)-2-azaspiro[4.4]nonane-1,3-dione, 95%, 2–(4–Bromophenyl)–2–azaspiro(4·4)nonane–1,3–dione. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g.
2-(4-bromophenyl)-2-azaspiro[4.4]nonane-1,3-dione (CAS 61343-15-5) is a chemical compound with the molecular formula C14H14BrNO2 and a molecular weight of 308.17 g/mol. IUPAC name: 2-(4-bromophenyl)-2-azaspiro[4.4]nonane-1,3-dione. InChIKey: FLWDMVIBOMUBNU-UHFFFAOYSA-N.
| Molecular formula | C14H14BrNO2 |
|---|---|
| Molecular weight | 308.17 g/mol |
| IUPAC name | 2-(4-bromophenyl)-2-azaspiro[4.4]nonane-1,3-dione |
| InChIKey | FLWDMVIBOMUBNU-UHFFFAOYSA-N |
| SMILES | C1CCC2(C1)CC(=O)N(C2=O)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)