CAS 763132-62-3 is the registry number for 4-Bromo-2-[(4-methoxyanilino)methyl]benzenol, 90%. Offered by: Combi-blocks. Available pack sizes: 100mg.
4-bromo-2-[(4-methoxyanilino)methyl]phenol (CAS 763132-62-3) is a chemical compound with the molecular formula C14H14BrNO2 and a molecular weight of 308.17 g/mol. IUPAC name: 4-bromo-2-[(4-methoxyanilino)methyl]phenol. InChIKey: YGTRENLQWRENHX-UHFFFAOYSA-N.
| Molecular formula | C14H14BrNO2 |
|---|---|
| Molecular weight | 308.17 g/mol |
| IUPAC name | 4-bromo-2-[(4-methoxyanilino)methyl]phenol |
| InChIKey | YGTRENLQWRENHX-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)NCC2=C(C=CC(=C2)Br)O |
Computed by PubChem (NCBI)