Products 1312769-71-3
CAS 1312769-71-3 is the registry number for 1,1-Dimethylethyl 2-nitro-4-(1-oxobutyl)benzoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g.
Tert-butyl 4-butanoyl-2-nitrobenzoate (CAS 1312769-71-3) is a chemical compound with the molecular formula C15H19NO5 and a molecular weight of 293.31 g/mol. IUPAC name: tert-butyl 4-butanoyl-2-nitrobenzoate. InChIKey: DNIRGJLFRXUAJM-UHFFFAOYSA-N.
| Molecular formula | C15H19NO5 |
|---|---|
| Molecular weight | 293.31 g/mol |
| IUPAC name | tert-butyl 4-butanoyl-2-nitrobenzoate |
| InChIKey | DNIRGJLFRXUAJM-UHFFFAOYSA-N |
| SMILES | CCCC(=O)C1=CC(=C(C=C1)C(=O)OC(C)(C)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)