CAS 1312888-74-6 is the registry number for 4-Bromo-2,2'-dimethyl-1,1'-biphenyl, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-bromo-2-methyl-1-(2-methylphenyl)benzene (CAS 1312888-74-6) is a chemical compound with the molecular formula C14H13Br and a molecular weight of 261.16 g/mol. IUPAC name: 4-bromo-2-methyl-1-(2-methylphenyl)benzene. InChIKey: ISSOEWGDFWAZOG-UHFFFAOYSA-N.
| Molecular formula | C14H13Br |
|---|---|
| Molecular weight | 261.16 g/mol |
| IUPAC name | 4-bromo-2-methyl-1-(2-methylphenyl)benzene |
| InChIKey | ISSOEWGDFWAZOG-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=C(C=C(C=C2)Br)C |
Computed by PubChem (NCBI)